5-[(4-fluorophenyl)methyl]-2-(thiophen-2-yl)pyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
5-[(4-fluorophenyl)methyl]-2-(thiophen-2-yl)pyrazolo[1,5-a]pyrazin-4(5H)-one
5-[(4-fluorophenyl)methyl]-2-(thiophen-2-yl)pyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | C200-5669 |
| Compound Name: | 5-[(4-fluorophenyl)methyl]-2-(thiophen-2-yl)pyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 325.36 |
| Molecular Formula: | C17 H12 F N3 O S |
| Smiles: | C(c1ccc(cc1)F)N1C=Cn2c(cc(c3cccs3)n2)C1=O |
| Stereo: | ACHIRAL |
| logP: | 2.4701 |
| logD: | 2.4701 |
| logSw: | -2.6728 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.989 |
| InChI Key: | VPVDCXGGQAPZAZ-UHFFFAOYSA-N |