2-(4-ethylbenzoyl)-7-fluoro-4-(3-methoxyphenyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Chemical Structure Depiction of
2-(4-ethylbenzoyl)-7-fluoro-4-(3-methoxyphenyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
2-(4-ethylbenzoyl)-7-fluoro-4-(3-methoxyphenyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Compound characteristics
| Compound ID: | C200-5808 |
| Compound Name: | 2-(4-ethylbenzoyl)-7-fluoro-4-(3-methoxyphenyl)-1lambda~6~,4-benzothiazine-1,1(4H)-dione |
| Molecular Weight: | 437.49 |
| Molecular Formula: | C24 H20 F N O4 S |
| Smiles: | CCc1ccc(cc1)C(C1=CN(c2cccc(c2)OC)c2ccc(cc2S1(=O)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8465 |
| logD: | 4.8465 |
| logSw: | -4.7061 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.961 |
| InChI Key: | NMMGCXYQGWJFMP-UHFFFAOYSA-N |