3-[methyl(4-methylphenyl)sulfamoyl]-4-phenyl-N-[(thiophen-2-yl)methyl]thiophene-2-carboxamide
Chemical Structure Depiction of
3-[methyl(4-methylphenyl)sulfamoyl]-4-phenyl-N-[(thiophen-2-yl)methyl]thiophene-2-carboxamide
3-[methyl(4-methylphenyl)sulfamoyl]-4-phenyl-N-[(thiophen-2-yl)methyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | C200-5823 |
| Compound Name: | 3-[methyl(4-methylphenyl)sulfamoyl]-4-phenyl-N-[(thiophen-2-yl)methyl]thiophene-2-carboxamide |
| Molecular Weight: | 482.64 |
| Molecular Formula: | C24 H22 N2 O3 S3 |
| Smiles: | Cc1ccc(cc1)N(C)S(c1c(csc1C(NCc1cccs1)=O)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5624 |
| logD: | 5.5624 |
| logSw: | -5.5139 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.238 |
| InChI Key: | VYABYFMBDRMLPY-UHFFFAOYSA-N |