2-benzoyl-4-(3-chlorophenyl)-6-fluoro-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Chemical Structure Depiction of
2-benzoyl-4-(3-chlorophenyl)-6-fluoro-1lambda~6~,4-benzothiazine-1,1(4H)-dione
2-benzoyl-4-(3-chlorophenyl)-6-fluoro-1lambda~6~,4-benzothiazine-1,1(4H)-dione
Compound characteristics
| Compound ID: | C200-5851 |
| Compound Name: | 2-benzoyl-4-(3-chlorophenyl)-6-fluoro-1lambda~6~,4-benzothiazine-1,1(4H)-dione |
| Molecular Weight: | 413.85 |
| Molecular Formula: | C21 H13 Cl F N O3 S |
| Smiles: | C1=C(C(c2ccccc2)=O)S(c2ccc(cc2N1c1cccc(c1)[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2893 |
| logD: | 4.2893 |
| logSw: | -4.6044 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.417 |
| InChI Key: | JKJUNTDNVUOVIG-UHFFFAOYSA-N |