(4-methylphenyl)methyl 5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(4-methylphenyl)methyl 5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxylate
(4-methylphenyl)methyl 5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | C200-5932 |
| Compound Name: | (4-methylphenyl)methyl 5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C18 H17 N3 O2 |
| Smiles: | Cc1ccc(COC(c2c(C)n(c3ccccc3)nn2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.298 |
| logD: | 3.298 |
| logSw: | -3.3884 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.939 |
| InChI Key: | HPYZJZJBTHFJDA-UHFFFAOYSA-N |