1-(2,4,6-trimethylbenzene-1-sulfonyl)-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one
Chemical Structure Depiction of
1-(2,4,6-trimethylbenzene-1-sulfonyl)-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one
1-(2,4,6-trimethylbenzene-1-sulfonyl)-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one
Compound characteristics
| Compound ID: | C200-6238 |
| Compound Name: | 1-(2,4,6-trimethylbenzene-1-sulfonyl)-1'H-spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one |
| Molecular Weight: | 399.51 |
| Molecular Formula: | C21 H25 N3 O3 S |
| Smiles: | Cc1cc(C)c(c(C)c1)S(N1CCC2(CC1)NC(c1ccccc1N2)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6344 |
| logD: | 3.6344 |
| logSw: | -3.8493 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.261 |
| InChI Key: | HKNYIWOELUCHGT-UHFFFAOYSA-N |