2-{[4-(3-chlorophenyl)-3H-1,5-benzodiazepin-2-yl]sulfanyl}-N-phenylacetamide
Chemical Structure Depiction of
2-{[4-(3-chlorophenyl)-3H-1,5-benzodiazepin-2-yl]sulfanyl}-N-phenylacetamide
2-{[4-(3-chlorophenyl)-3H-1,5-benzodiazepin-2-yl]sulfanyl}-N-phenylacetamide
Compound characteristics
| Compound ID: | C200-6504 |
| Compound Name: | 2-{[4-(3-chlorophenyl)-3H-1,5-benzodiazepin-2-yl]sulfanyl}-N-phenylacetamide |
| Molecular Weight: | 419.93 |
| Molecular Formula: | C23 H18 Cl N3 O S |
| Smiles: | C1C(c2cccc(c2)[Cl])=Nc2ccccc2N=C1SCC(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1199 |
| logD: | 5.1192 |
| logSw: | -5.5827 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.339 |
| InChI Key: | ROSSJYBHQKGVGQ-UHFFFAOYSA-N |