8-methyl-3-(2-phenylpropyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
8-methyl-3-(2-phenylpropyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
8-methyl-3-(2-phenylpropyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | C200-7096 |
| Compound Name: | 8-methyl-3-(2-phenylpropyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 317.39 |
| Molecular Formula: | C20 H19 N3 O |
| Smiles: | CC(CN1C=Nc2c3cc(C)ccc3[nH]c2C1=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0155 |
| logD: | 4.0155 |
| logSw: | -4.143 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.297 |
| InChI Key: | ACFVCOYRHHFFGU-AWEZNQCLSA-N |