(3,5-dimethyl-1H-pyrazol-1-yl)[3-(4-phenylpiperazine-1-sulfonyl)thiophen-2-yl]methanone
Chemical Structure Depiction of
(3,5-dimethyl-1H-pyrazol-1-yl)[3-(4-phenylpiperazine-1-sulfonyl)thiophen-2-yl]methanone
(3,5-dimethyl-1H-pyrazol-1-yl)[3-(4-phenylpiperazine-1-sulfonyl)thiophen-2-yl]methanone
Compound characteristics
| Compound ID: | C200-7404 |
| Compound Name: | (3,5-dimethyl-1H-pyrazol-1-yl)[3-(4-phenylpiperazine-1-sulfonyl)thiophen-2-yl]methanone |
| Molecular Weight: | 430.55 |
| Molecular Formula: | C20 H22 N4 O3 S2 |
| Smiles: | Cc1cc(C)n(C(c2c(ccs2)S(N2CCN(CC2)c2ccccc2)(=O)=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.2874 |
| logD: | 2.2874 |
| logSw: | -2.6442 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.296 |
| InChI Key: | NVSRWSQBRXINFQ-UHFFFAOYSA-N |