3-(3-ethoxypropyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}-5-methyl-7-phenyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
Chemical Structure Depiction of
3-(3-ethoxypropyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}-5-methyl-7-phenyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
3-(3-ethoxypropyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}-5-methyl-7-phenyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
Compound characteristics
| Compound ID: | C200-8009 |
| Compound Name: | 3-(3-ethoxypropyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}-5-methyl-7-phenyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one |
| Molecular Weight: | 463.6 |
| Molecular Formula: | C26 H29 N3 O3 S |
| Smiles: | CCOCCCN1C(=Nc2c(cn(C)c2C1=O)c1ccccc1)SCc1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.7405 |
| logD: | 4.7405 |
| logSw: | -4.4291 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.716 |
| InChI Key: | KRUXFVGNNJGINC-UHFFFAOYSA-N |