ethyl 1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
ethyl 1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
ethyl 1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | C200-8187 |
| Compound Name: | ethyl 1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 231.25 |
| Molecular Formula: | C12 H13 N3 O2 |
| Smiles: | CCOC(c1cn(c2ccc(C)cc2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3657 |
| logD: | 2.3657 |
| logSw: | -2.3953 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.357 |
| InChI Key: | JTFQDRRMBVEOHD-UHFFFAOYSA-N |