N-(3-chloro-4-methylphenyl)-2-(3,5-dimethyl-1H-pyrazole-1-carbonyl)-N-methylthiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-(3,5-dimethyl-1H-pyrazole-1-carbonyl)-N-methylthiophene-3-sulfonamide
N-(3-chloro-4-methylphenyl)-2-(3,5-dimethyl-1H-pyrazole-1-carbonyl)-N-methylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | C200-9215 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-(3,5-dimethyl-1H-pyrazole-1-carbonyl)-N-methylthiophene-3-sulfonamide |
| Molecular Weight: | 423.94 |
| Molecular Formula: | C18 H18 Cl N3 O3 S2 |
| Smiles: | Cc1ccc(cc1[Cl])N(C)S(c1ccsc1C(n1c(C)cc(C)n1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8463 |
| logD: | 3.8463 |
| logSw: | -4.1691 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.145 |
| InChI Key: | QKFVPZGUPOHROU-UHFFFAOYSA-N |