{3-[4-(3-chlorophenyl)piperazine-1-sulfonyl]thiophen-2-yl}(3,5-dimethyl-1H-pyrazol-1-yl)methanone
Chemical Structure Depiction of
{3-[4-(3-chlorophenyl)piperazine-1-sulfonyl]thiophen-2-yl}(3,5-dimethyl-1H-pyrazol-1-yl)methanone
{3-[4-(3-chlorophenyl)piperazine-1-sulfonyl]thiophen-2-yl}(3,5-dimethyl-1H-pyrazol-1-yl)methanone
Compound characteristics
| Compound ID: | C200-9226 |
| Compound Name: | {3-[4-(3-chlorophenyl)piperazine-1-sulfonyl]thiophen-2-yl}(3,5-dimethyl-1H-pyrazol-1-yl)methanone |
| Molecular Weight: | 464.99 |
| Molecular Formula: | C20 H21 Cl N4 O3 S2 |
| Smiles: | Cc1cc(C)n(C(c2c(ccs2)S(N2CCN(CC2)c2cccc(c2)[Cl])(=O)=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.871 |
| logD: | 2.871 |
| logSw: | -3.345 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.296 |
| InChI Key: | VHCVKFKMYCGJBB-UHFFFAOYSA-N |