2-(3-benzyl-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl)-N-(2-ethoxyphenyl)acetamide
Chemical Structure Depiction of
2-(3-benzyl-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl)-N-(2-ethoxyphenyl)acetamide
2-(3-benzyl-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl)-N-(2-ethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | C201-1029 |
| Compound Name: | 2-(3-benzyl-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl)-N-(2-ethoxyphenyl)acetamide |
| Molecular Weight: | 431.45 |
| Molecular Formula: | C23 H21 N5 O4 |
| Smiles: | CCOc1ccccc1NC(CN1C(N(Cc2ccccc2)C(c2c1nccn2)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9089 |
| logD: | 2.9088 |
| logSw: | -3.1543 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.169 |
| InChI Key: | IXNCONMIGCKXGN-UHFFFAOYSA-N |