N-(2-ethoxyphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
N-(2-ethoxyphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | C201-1033 |
| Compound Name: | N-(2-ethoxyphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide |
| Molecular Weight: | 461.48 |
| Molecular Formula: | C24 H23 N5 O5 |
| Smiles: | CCOc1ccccc1NC(CN1C(N(Cc2ccc(cc2)OC)C(c2c1nccn2)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8912 |
| logD: | 2.8912 |
| logSw: | -3.2142 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.712 |
| InChI Key: | DTKAFCLBCNNSDK-UHFFFAOYSA-N |