N-(2,3-dimethylphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
N-(2,3-dimethylphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | C201-1034 |
| Compound Name: | N-(2,3-dimethylphenyl)-2-{3-[(4-methoxyphenyl)methyl]-2,4-dioxo-3,4-dihydropteridin-1(2H)-yl}acetamide |
| Molecular Weight: | 445.48 |
| Molecular Formula: | C24 H23 N5 O4 |
| Smiles: | Cc1cccc(c1C)NC(CN1C(N(Cc2ccc(cc2)OC)C(c2c1nccn2)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3471 |
| logD: | 3.3471 |
| logSw: | -3.2557 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.502 |
| InChI Key: | SVFLUNATHNTTID-UHFFFAOYSA-N |