3-{[2-(4-ethylanilino)-2-oxoethyl]sulfanyl}-N-(4-methylphenyl)[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
Chemical Structure Depiction of
3-{[2-(4-ethylanilino)-2-oxoethyl]sulfanyl}-N-(4-methylphenyl)[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
3-{[2-(4-ethylanilino)-2-oxoethyl]sulfanyl}-N-(4-methylphenyl)[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
Compound characteristics
| Compound ID: | C201-1067 |
| Compound Name: | 3-{[2-(4-ethylanilino)-2-oxoethyl]sulfanyl}-N-(4-methylphenyl)[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| Molecular Weight: | 445.54 |
| Molecular Formula: | C24 H23 N5 O2 S |
| Smiles: | CCc1ccc(cc1)NC(CSc1nnc2ccc(cn12)C(Nc1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.714 |
| logD: | 4.714 |
| logSw: | -4.1494 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.293 |
| InChI Key: | YQMGDGQFUCAGID-UHFFFAOYSA-N |