N-(4-chlorophenyl)-2-{[4-(piperidin-1-yl)phthalazin-1-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-{[4-(piperidin-1-yl)phthalazin-1-yl]sulfanyl}acetamide
N-(4-chlorophenyl)-2-{[4-(piperidin-1-yl)phthalazin-1-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | C201-1371 |
| Compound Name: | N-(4-chlorophenyl)-2-{[4-(piperidin-1-yl)phthalazin-1-yl]sulfanyl}acetamide |
| Molecular Weight: | 412.94 |
| Molecular Formula: | C21 H21 Cl N4 O S |
| Smiles: | C1CCN(CC1)c1c2ccccc2c(nn1)SCC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1496 |
| logD: | 5.1494 |
| logSw: | -5.674 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.105 |
| InChI Key: | FQWCPDWOMQJZHO-UHFFFAOYSA-N |