N-(2-ethylphenyl)-2-{[4-(morpholin-4-yl)phthalazin-1-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-2-{[4-(morpholin-4-yl)phthalazin-1-yl]sulfanyl}acetamide
N-(2-ethylphenyl)-2-{[4-(morpholin-4-yl)phthalazin-1-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | C201-1418 |
| Compound Name: | N-(2-ethylphenyl)-2-{[4-(morpholin-4-yl)phthalazin-1-yl]sulfanyl}acetamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C22 H24 N4 O2 S |
| Smiles: | CCc1ccccc1NC(CSc1c2ccccc2c(nn1)N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8957 |
| logD: | 3.8957 |
| logSw: | -3.7496 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.315 |
| InChI Key: | KHAGTXCPPXGVRB-UHFFFAOYSA-N |