2-chloro-4-(4-methylpiperidin-1-yl)quinazoline
Chemical Structure Depiction of
2-chloro-4-(4-methylpiperidin-1-yl)quinazoline
2-chloro-4-(4-methylpiperidin-1-yl)quinazoline
Compound characteristics
| Compound ID: | C201-2022 |
| Compound Name: | 2-chloro-4-(4-methylpiperidin-1-yl)quinazoline |
| Molecular Weight: | 261.75 |
| Molecular Formula: | C14 H16 Cl N3 |
| Smiles: | CC1CCN(CC1)c1c2ccccc2nc(n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.2292 |
| logD: | 4.2291 |
| logSw: | -4.3326 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 21.6439 |
| InChI Key: | IVXIVJCXRJVQTI-UHFFFAOYSA-N |