N,N-diethyl-4-(2-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
Chemical Structure Depiction of
N,N-diethyl-4-(2-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
N,N-diethyl-4-(2-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide
Compound characteristics
| Compound ID: | C202-0991 |
| Compound Name: | N,N-diethyl-4-(2-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| Molecular Weight: | 378.45 |
| Molecular Formula: | C22 H23 F N4 O |
| Smiles: | CCN(CC)C(C1C(c2ccccc2F)n2c3ccccc3nc2NC=1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1141 |
| logD: | 4.1127 |
| logSw: | -4.0612 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.966 |
| InChI Key: | MJLAENBREXKYJJ-FQEVSTJZSA-N |