ethyl 2-(ethylsulfanyl)-5-methyl-7-(2-methylphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 2-(ethylsulfanyl)-5-methyl-7-(2-methylphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate
ethyl 2-(ethylsulfanyl)-5-methyl-7-(2-methylphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | C202-2669 |
| Compound Name: | ethyl 2-(ethylsulfanyl)-5-methyl-7-(2-methylphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 358.46 |
| Molecular Formula: | C18 H22 N4 O2 S |
| Smiles: | CCOC(C1C(c2ccccc2C)n2c(NC=1C)nc(n2)SCC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.241 |
| logD: | 4.0727 |
| logSw: | -4.0282 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.525 |
| InChI Key: | HJJOCQRNMFEFPY-HNNXBMFYSA-N |