N-(4-ethoxyphenyl)-2,5-dioxo-7-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2,5-dioxo-7-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
N-(4-ethoxyphenyl)-2,5-dioxo-7-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | C202-3126 |
| Compound Name: | N-(4-ethoxyphenyl)-2,5-dioxo-7-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C24 H22 N2 O4 |
| Smiles: | CCOc1ccc(cc1)NC(C1=CC2=C(CC(CC2=O)c2ccccc2)NC1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8234 |
| logD: | 0.0394 |
| logSw: | -4.0223 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.278 |
| InChI Key: | CVVHNULHWHMWBY-INIZCTEOSA-N |