4-(4-chlorophenyl)-5-(2-fluorophenyl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
4-(4-chlorophenyl)-5-(2-fluorophenyl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
4-(4-chlorophenyl)-5-(2-fluorophenyl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | C202-3552 |
| Compound Name: | 4-(4-chlorophenyl)-5-(2-fluorophenyl)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 423.87 |
| Molecular Formula: | C24 H19 Cl F N O3 |
| Smiles: | COc1ccc(CN2C(C(=C(C2=O)O)c2ccc(cc2)[Cl])c2ccccc2F)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0849 |
| logD: | 5.0843 |
| logSw: | -5.2211 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.632 |
| InChI Key: | SFGWKRDFUVAIRG-JOCHJYFZSA-N |