2-[5-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-4-methyl-1,3-thiazole
Chemical Structure Depiction of
2-[5-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-4-methyl-1,3-thiazole
2-[5-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-4-methyl-1,3-thiazole
Compound characteristics
| Compound ID: | C202-3803 |
| Compound Name: | 2-[5-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-4-methyl-1,3-thiazole |
| Molecular Weight: | 413.92 |
| Molecular Formula: | C21 H20 Cl N3 O2 S |
| Smiles: | Cc1csc(n1)N1C(CC(c2cc(ccc2OC)OC)=N1)c1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9253 |
| logD: | 5.9243 |
| logSw: | -6.3479 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.72 |
| InChI Key: | RQFCKNQZHKZZJI-IBGZPJMESA-N |