2-[(2-bromophenyl)methylidene]-2H-1,4-benzothiazin-3(4H)-one
Chemical Structure Depiction of
2-[(2-bromophenyl)methylidene]-2H-1,4-benzothiazin-3(4H)-one
2-[(2-bromophenyl)methylidene]-2H-1,4-benzothiazin-3(4H)-one
Compound characteristics
| Compound ID: | C202-3965 |
| Compound Name: | 2-[(2-bromophenyl)methylidene]-2H-1,4-benzothiazin-3(4H)-one |
| Molecular Weight: | 332.22 |
| Molecular Formula: | C15 H10 Br N O S |
| Smiles: | C(=C1/C(Nc2ccccc2S1)=O)/c1ccccc1[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.1986 |
| logD: | 4.1986 |
| logSw: | -4.4373 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.8445 |
| InChI Key: | GPKJHQREKKTAPD-UHFFFAOYSA-N |