N-(4-fluorophenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-fluorophenyl)thiophene-2-sulfonamide
N-(4-fluorophenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | C206-0706 |
| Compound Name: | N-(4-fluorophenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 257.3 |
| Molecular Formula: | C10 H8 F N O2 S2 |
| Smiles: | c1cc(sc1)S(Nc1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7581 |
| logD: | 2.6174 |
| logSw: | -3.2091 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.906 |
| InChI Key: | IQFWIVSCRQOMHS-UHFFFAOYSA-N |