N-(2,5-dimethoxyphenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)thiophene-2-sulfonamide
N-(2,5-dimethoxyphenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | C206-0721 |
| Compound Name: | N-(2,5-dimethoxyphenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 299.36 |
| Molecular Formula: | C12 H13 N O4 S2 |
| Smiles: | COc1ccc(c(c1)NS(c1cccs1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.5505 |
| logD: | 2.1317 |
| logSw: | -2.8898 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.383 |
| InChI Key: | UVLTTWYCUQDHEY-UHFFFAOYSA-N |