N-{1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl}thiophene-2-sulfonamide
Chemical Structure Depiction of
N-{1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl}thiophene-2-sulfonamide
N-{1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl}thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | C224-0102 |
| Compound Name: | N-{1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl}thiophene-2-sulfonamide |
| Molecular Weight: | 435.61 |
| Molecular Formula: | C21 H29 N3 O3 S2 |
| Smiles: | CC(C)C(C(N1CCN(CC1)c1cccc(C)c1C)=O)NS(c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9294 |
| logD: | 3.9283 |
| logSw: | -3.9299 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.46 |
| InChI Key: | VFIZFTOAJYWGIS-FQEVSTJZSA-N |