N~3~-(5-bromothiophene-2-sulfonyl)-N-cyclohexyl-beta-alaninamide
Chemical Structure Depiction of
N~3~-(5-bromothiophene-2-sulfonyl)-N-cyclohexyl-beta-alaninamide
N~3~-(5-bromothiophene-2-sulfonyl)-N-cyclohexyl-beta-alaninamide
Compound characteristics
| Compound ID: | C224-3164 |
| Compound Name: | N~3~-(5-bromothiophene-2-sulfonyl)-N-cyclohexyl-beta-alaninamide |
| Molecular Weight: | 395.33 |
| Molecular Formula: | C13 H19 Br N2 O3 S2 |
| Smiles: | C1CCC(CC1)NC(CCNS(c1ccc(s1)[Br])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0372 |
| logD: | 3.0371 |
| logSw: | -3.4204 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.053 |
| InChI Key: | DNCYEFQZVCBIIU-UHFFFAOYSA-N |