N-(4-bromo-3-methylphenyl)-4-[3-(thiophene-2-sulfonyl)propanamido]benzamide
Chemical Structure Depiction of
N-(4-bromo-3-methylphenyl)-4-[3-(thiophene-2-sulfonyl)propanamido]benzamide
N-(4-bromo-3-methylphenyl)-4-[3-(thiophene-2-sulfonyl)propanamido]benzamide
Compound characteristics
| Compound ID: | C224-4843 |
| Compound Name: | N-(4-bromo-3-methylphenyl)-4-[3-(thiophene-2-sulfonyl)propanamido]benzamide |
| Molecular Weight: | 507.42 |
| Molecular Formula: | C21 H19 Br N2 O4 S2 |
| Smiles: | Cc1cc(ccc1[Br])NC(c1ccc(cc1)NC(CCS(c1cccs1)(=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0112 |
| logD: | 4.0068 |
| logSw: | -4.1456 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.262 |
| InChI Key: | SWPVYQPSLCSOGC-UHFFFAOYSA-N |