(azepan-1-yl)[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanone
Chemical Structure Depiction of
(azepan-1-yl)[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanone
(azepan-1-yl)[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanone
Compound characteristics
| Compound ID: | C226-0247 |
| Compound Name: | (azepan-1-yl)[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methanone |
| Molecular Weight: | 288.32 |
| Molecular Formula: | C16 H17 F N2 O2 |
| Smiles: | C1CCCN(CC1)C(c1cc(c2ccc(cc2)F)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6201 |
| logD: | 3.6201 |
| logSw: | -3.7418 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.753 |
| InChI Key: | MPRSEXIRMVUNOH-UHFFFAOYSA-N |