[5-(4-fluorophenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
Chemical Structure Depiction of
[5-(4-fluorophenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
[5-(4-fluorophenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
Compound characteristics
| Compound ID: | C226-0252 |
| Compound Name: | [5-(4-fluorophenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone |
| Molecular Weight: | 288.32 |
| Molecular Formula: | C16 H17 F N2 O2 |
| Smiles: | CC1CCCCN1C(c1cc(c2ccc(cc2)F)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3804 |
| logD: | 3.3804 |
| logSw: | -3.5397 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.707 |
| InChI Key: | JJIWFEDTCKZPPG-NSHDSACASA-N |