N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide
N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0309 |
| Compound Name: | N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-5-(4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 392.39 |
| Molecular Formula: | C21 H17 F N4 O3 |
| Smiles: | CC1=C(C(N(c2ccccc2)N1C)=O)NC(c1cc(c2ccc(cc2)F)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4374 |
| logD: | 2.3759 |
| logSw: | -2.9915 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.246 |
| InChI Key: | WUMNHKKJBGXWNW-UHFFFAOYSA-N |