[5-(4-chlorophenyl)-1,2-oxazol-3-yl](2,6-dimethylpiperidin-1-yl)methanone
Chemical Structure Depiction of
[5-(4-chlorophenyl)-1,2-oxazol-3-yl](2,6-dimethylpiperidin-1-yl)methanone
[5-(4-chlorophenyl)-1,2-oxazol-3-yl](2,6-dimethylpiperidin-1-yl)methanone
Compound characteristics
| Compound ID: | C226-0352 |
| Compound Name: | [5-(4-chlorophenyl)-1,2-oxazol-3-yl](2,6-dimethylpiperidin-1-yl)methanone |
| Molecular Weight: | 318.8 |
| Molecular Formula: | C17 H19 Cl N2 O2 |
| Smiles: | CC1CCCC(C)N1C(c1cc(c2ccc(cc2)[Cl])on1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.2 |
| logD: | 4.2 |
| logSw: | -4.52 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.646 |
| InChI Key: | WREMICFWYHPOKH-UHFFFAOYSA-N |