(4-benzylpiperazin-1-yl)[5-(4-bromophenyl)-1,2-oxazol-3-yl]methanone
Chemical Structure Depiction of
(4-benzylpiperazin-1-yl)[5-(4-bromophenyl)-1,2-oxazol-3-yl]methanone
(4-benzylpiperazin-1-yl)[5-(4-bromophenyl)-1,2-oxazol-3-yl]methanone
Compound characteristics
| Compound ID: | C226-0485 |
| Compound Name: | (4-benzylpiperazin-1-yl)[5-(4-bromophenyl)-1,2-oxazol-3-yl]methanone |
| Molecular Weight: | 426.31 |
| Molecular Formula: | C21 H20 Br N3 O2 |
| Smiles: | C1CN(CCN1Cc1ccccc1)C(c1cc(c2ccc(cc2)[Br])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2453 |
| logD: | 4.2297 |
| logSw: | -4.3249 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.962 |
| InChI Key: | YVPLVAPOPRNCBC-UHFFFAOYSA-N |