ethyl 2-{[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino}-4,5-dimethylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino}-4,5-dimethylthiophene-3-carboxylate
ethyl 2-{[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino}-4,5-dimethylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | C226-0554 |
| Compound Name: | ethyl 2-{[5-(4-bromophenyl)-1,2-oxazole-3-carbonyl]amino}-4,5-dimethylthiophene-3-carboxylate |
| Molecular Weight: | 449.32 |
| Molecular Formula: | C19 H17 Br N2 O4 S |
| Smiles: | CCOC(c1c(C)c(C)sc1NC(c1cc(c2ccc(cc2)[Br])on1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3267 |
| logD: | 2.9851 |
| logSw: | -5.4545 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.413 |
| InChI Key: | YIBMSRVLUASJEX-UHFFFAOYSA-N |