5-(4-bromophenyl)-N-{3,5-dimethyl-1-[(2-methylphenyl)methyl]-1H-pyrazol-4-yl}-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(4-bromophenyl)-N-{3,5-dimethyl-1-[(2-methylphenyl)methyl]-1H-pyrazol-4-yl}-1,2-oxazole-3-carboxamide
5-(4-bromophenyl)-N-{3,5-dimethyl-1-[(2-methylphenyl)methyl]-1H-pyrazol-4-yl}-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0570 |
| Compound Name: | 5-(4-bromophenyl)-N-{3,5-dimethyl-1-[(2-methylphenyl)methyl]-1H-pyrazol-4-yl}-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 465.35 |
| Molecular Formula: | C23 H21 Br N4 O2 |
| Smiles: | Cc1ccccc1Cn1c(C)c(c(C)n1)NC(c1cc(c2ccc(cc2)[Br])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9464 |
| logD: | 4.9462 |
| logSw: | -4.6053 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.751 |
| InChI Key: | MYGCCTGNQMFDPF-UHFFFAOYSA-N |