N-(2-chloropyridin-3-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(2-chloropyridin-3-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
N-(2-chloropyridin-3-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0638 |
| Compound Name: | N-(2-chloropyridin-3-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 315.71 |
| Molecular Formula: | C15 H10 Cl N3 O3 |
| Smiles: | c1cc(c(nc1)[Cl])NC(c1cc(c2ccc(cc2)O)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6481 |
| logD: | 2.6452 |
| logSw: | -3.3608 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.469 |
| InChI Key: | RXMZKLOQRXKFQT-UHFFFAOYSA-N |