N-(2H-1,3-benzodioxol-5-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(2H-1,3-benzodioxol-5-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
N-(2H-1,3-benzodioxol-5-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0645 |
| Compound Name: | N-(2H-1,3-benzodioxol-5-yl)-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 324.29 |
| Molecular Formula: | C17 H12 N2 O5 |
| Smiles: | C1Oc2ccc(cc2O1)NC(c1cc(c2ccc(cc2)O)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0452 |
| logD: | 3.0422 |
| logSw: | -3.3086 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.597 |
| InChI Key: | DRHPRTMSUXRJTF-UHFFFAOYSA-N |