N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0675 |
| Compound Name: | N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 429.26 |
| Molecular Formula: | C20 H14 Cl2 N4 O3 |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])n1cc(cn1)NC(c1cc(c2ccc(cc2)O)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.353 |
| logD: | 4.3501 |
| logSw: | -4.2758 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.988 |
| InChI Key: | HSWJYZZIJYONGE-UHFFFAOYSA-N |