N,N-diethyl-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N,N-diethyl-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
N,N-diethyl-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0730 |
| Compound Name: | N,N-diethyl-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 274.32 |
| Molecular Formula: | C15 H18 N2 O3 |
| Smiles: | CCN(CC)C(c1cc(c2ccc(cc2)OC)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7281 |
| logD: | 2.7281 |
| logSw: | -3.0011 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.25 |
| InChI Key: | XHVTXRSIWQMOKK-UHFFFAOYSA-N |