N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0789 |
| Compound Name: | N-{1-[(2,4-dichlorophenyl)methyl]-1H-pyrazol-4-yl}-5-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 443.29 |
| Molecular Formula: | C21 H16 Cl2 N4 O3 |
| Smiles: | COc1ccc(cc1)c1cc(C(Nc2cnn(Cc3ccc(cc3[Cl])[Cl])c2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.9552 |
| logD: | 4.9549 |
| logSw: | -5.0939 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.914 |
| InChI Key: | SLUJOBSTSXJCCS-UHFFFAOYSA-N |