N-(3-hydroxyphenyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(3-hydroxyphenyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-(3-hydroxyphenyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0869 |
| Compound Name: | N-(3-hydroxyphenyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 310.31 |
| Molecular Formula: | C17 H14 N2 O4 |
| Smiles: | COc1cccc(c1)c1cc(C(Nc2cccc(c2)O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.1821 |
| logD: | 3.1643 |
| logSw: | -3.274 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.026 |
| InChI Key: | NLCURIHWDCRJLW-UHFFFAOYSA-N |