N-{1-[(4-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
					Chemical Structure Depiction of
N-{1-[(4-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
			N-{1-[(4-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0898 | 
| Compound Name: | N-{1-[(4-fluorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide | 
| Molecular Weight: | 420.44 | 
| Molecular Formula: | C23 H21 F N4 O3 | 
| Smiles: | Cc1c(c(C)n(Cc2ccc(cc2)F)n1)NC(c1cc(c2cccc(c2)OC)on1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.3175 | 
| logD: | 3.3174 | 
| logSw: | -3.6084 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 65.295 | 
| InChI Key: | YABBLUMHGYNYGM-UHFFFAOYSA-N | 
 
				 
				