N-{1-[(3,4-dichlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-{1-[(3,4-dichlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-{1-[(3,4-dichlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0902 |
| Compound Name: | N-{1-[(3,4-dichlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 471.34 |
| Molecular Formula: | C23 H20 Cl2 N4 O3 |
| Smiles: | Cc1c(c(C)n(Cc2ccc(c(c2)[Cl])[Cl])n1)NC(c1cc(c2cccc(c2)OC)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6056 |
| logD: | 4.6055 |
| logSw: | -4.7395 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.295 |
| InChI Key: | OUECAQBFICOWID-UHFFFAOYSA-N |