5-(2-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(2-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide
5-(2-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0979 |
| Compound Name: | 5-(2-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 362.31 |
| Molecular Formula: | C18 H13 F3 N2 O3 |
| Smiles: | COc1ccccc1c1cc(C(Nc2ccccc2C(F)(F)F)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.2391 |
| logD: | 4.2391 |
| logSw: | -4.4722 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.798 |
| InChI Key: | ZOUCQYNBHQKVHU-UHFFFAOYSA-N |