N-(2-chloropyridin-3-yl)-5-(2-methoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(2-chloropyridin-3-yl)-5-(2-methoxyphenyl)-1,2-oxazole-3-carboxamide
N-(2-chloropyridin-3-yl)-5-(2-methoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-0980 |
| Compound Name: | N-(2-chloropyridin-3-yl)-5-(2-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 329.74 |
| Molecular Formula: | C16 H12 Cl N3 O3 |
| Smiles: | COc1ccccc1c1cc(C(Nc2cccnc2[Cl])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.9613 |
| logD: | 2.9607 |
| logSw: | -3.6678 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.483 |
| InChI Key: | TVNPLVPYYPVFDQ-UHFFFAOYSA-N |