N-(3-acetylphenyl)-5-(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(3-acetylphenyl)-5-(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide
N-(3-acetylphenyl)-5-(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-1108 |
| Compound Name: | N-(3-acetylphenyl)-5-(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 366.37 |
| Molecular Formula: | C20 H18 N2 O5 |
| Smiles: | CC(c1cccc(c1)NC(c1cc(c2ccc(c(c2)OC)OC)on1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1017 |
| logD: | 3.1016 |
| logSw: | -3.388 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.952 |
| InChI Key: | BBTPLFPJUVDNFG-UHFFFAOYSA-N |