5-(3-chlorophenyl)-N-(4-methylphenyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(3-chlorophenyl)-N-(4-methylphenyl)-1,2-oxazole-3-carboxamide
5-(3-chlorophenyl)-N-(4-methylphenyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-1456 |
| Compound Name: | 5-(3-chlorophenyl)-N-(4-methylphenyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 312.75 |
| Molecular Formula: | C17 H13 Cl N2 O2 |
| Smiles: | Cc1ccc(cc1)NC(c1cc(c2cccc(c2)[Cl])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8228 |
| logD: | 4.8228 |
| logSw: | -4.8243 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.865 |
| InChI Key: | LVPCICOWCCGQDT-UHFFFAOYSA-N |